CAS 124438-73-9

1-(6-Chloro-3-pyridazinyl)-4-piperidineethanol

Description:

1-(6-Chloro-3-pyridazinyl)-4-piperidineethanol, with the CAS number 124438-73-9, is a chemical compound characterized by its unique structure, which includes a pyridazine ring and a piperidine moiety. The presence of a chlorine atom at the 6-position of the pyridazine ring contributes to its reactivity and potential biological activity. This compound is typically classified as an organic amine due to the piperidine group, which features a six-membered ring containing nitrogen. The hydroxyl group (-OH) in the ethanol portion of the molecule enhances its solubility in polar solvents and may influence its pharmacological properties. Compounds of this nature are often investigated for their potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. The specific interactions and effects of this compound would depend on its conformation, substituent effects, and the presence of functional groups, making it a subject of interest in both synthetic and medicinal chemistry research.

Formula: C₁₁H₁₆ClN₃O

InChI: InChI=1S/C11H16ClN3O/c12-10-1-2-11(14-13-10)15-6-3-9(4-7-15)5-8-16/h1-2,9,16H,3-8H2

InChI key: InChIKey=ZOTJNOZWPQHVMJ-UHFFFAOYSA-N

SMILES: C(CO)C1CCN(CC1)C2=CC=C(Cl)N=N2

Synonyms:

• 1-(6-Chloro-3-pyridazinyl)-4-piperidineethanol
• 4-Piperidineethanol, 1-(6-chloro-3-pyridazinyl)-