CAS 124442-15-5

(2Z)-2-(2-Thienylmethylene)-1,6-dioxaspiro[4.4]non-3-ene

Description:

(2Z)-2-(2-Thienylmethylene)-1,6-dioxaspiro[4.4]non-3-ene is a chemical compound characterized by its unique spirocyclic structure, which features a spiro linkage between two rings. The presence of a thienyl group indicates that it contains a thiophene ring, contributing to its aromatic properties and potential reactivity. The compound also includes a dioxaspiro moiety, which introduces oxygen atoms into the structure, enhancing its chemical versatility. This compound may exhibit interesting optical properties due to its geometric configuration, particularly the Z-configuration of the double bond, which can influence its interactions with light and other molecules. Additionally, the spiro structure can lead to unique steric and electronic effects, potentially impacting its stability and reactivity in various chemical environments. Such compounds are often studied for their potential applications in materials science, organic synthesis, and medicinal chemistry, where their distinctive structural features can be leveraged for specific functionalities.

Formula: C₁₂H₁₂O₂S

InChI: InChI=1/C12H12O2S/c1-3-11(15-8-1)9-10-4-6-12(14-10)5-2-7-13-12/h1,3-4,6,8-9H,2,5,7H2/b10-9-

InChI key: InChIKey=LLZQYUSTIRVCPF-KTKRTIGZNA-N

SMILES: C(=C/1\OC2(C=C1)CCCO2)\C3=CC=CS3

Synonyms:

• 1,6-Dioxaspiro[4.4]non-3-ene, 2-(2-thienylmethylene)-, (Z)-
• 1,6-Dioxaspiro[4.4]non-3-ene, 2-(2-thienylmethylene)-, (2Z)-
• (2Z)-2-(2-Thienylmethylene)-1,6-dioxaspiro[4.4]non-3-ene

1,6-Dioxaspiro[4.4]non-3-ene, 2-(2-thienylmethylene)-, (2Z)-

CAS: 124442-15-5

Formula: C₁₂H₁₂O₂S

Molecular weight: 220.2875

Ref: IN-DA000M1I