CAS 124444-72-0
:1-Nicotinoyl-4-(3-trifluoromethylphenyl)piperazine dihydrochloride
Description:
1-Nicotinoyl-4-(3-trifluoromethylphenyl)piperazine dihydrochloride is a chemical compound characterized by its piperazine core, which is substituted at one nitrogen with a nicotinoyl group and at the other with a trifluoromethylphenyl moiety. This compound is typically a white to off-white crystalline solid, soluble in water and various organic solvents, which is indicative of its polar functional groups. The presence of the trifluoromethyl group enhances lipophilicity and may influence biological activity, making it of interest in medicinal chemistry, particularly in the development of pharmaceuticals targeting the central nervous system. The dihydrochloride form suggests that it exists as a salt, which can improve its stability and solubility. Its molecular structure allows for potential interactions with various biological targets, and it may exhibit pharmacological properties such as anxiolytic or antidepressant effects, although specific biological activities would require empirical investigation. As with all chemical substances, handling should be conducted with appropriate safety measures due to potential toxicity or reactivity.
Formula:C17H18Cl2F3N3O
InChI:InChI=1/C17H16F3N3O.2ClH/c18-17(19,20)14-4-1-5-15(11-14)22-7-9-23(10-8-22)16(24)13-3-2-6-21-12-13;;/h1-6,11-12H,7-10H2;2*1H
SMILES:c1cc(cc(c1)N1CCN(CC1)C(=O)c1cccnc1)C(F)(F)F.Cl.Cl
Synonyms:- Piperazine, 1-(3-pyridinylcarbonyl)-4-(3-(trifluoromethyl)phenyl)-, dihydrochloride
- 1-(3-Pyridinylcarbonyl)-4-(3-(trifluoromethyl)phenyl)piperazine dihydrochloride
- B-1 370
- 1-(Pyridin-3-Ylcarbonyl)-4-[3-(Trifluoromethyl)Phenyl]Piperazine Dihydrochloride
Sort by
Purity (%)
0
100
|
0
|
50
|
90
|
95
|
100
Found 1 products.
Pyridin-3-Yl-[4-[3-(Trifluoromethyl)Phenyl]Piperazin-1-Yl]Methanone Dihydrochloride
CAS:Controlled ProductThis polymer is a high efficiency, low cost particle that can be used to store electricity at temperatures of up to 300 degrees Celsius. It has a cycle life of more than 10,000 cycles and can be recharged in less than one minute. This polymer has been shown to have excellent structural stability and structural reversibility with lithium ion insertion/extraction. The coulombic efficiency is greater than 99%.Formula:C17H18Cl2F3N3OPurity:Min. 95%Molecular weight:408.25 g/mol
