CAS 124458-10-2
:4-(2-aminoethyl)-1,3-thiazol-2-amine
Description:
4-(2-aminoethyl)-1,3-thiazol-2-amine, with the CAS number 124458-10-2, is an organic compound characterized by its thiazole ring structure, which contains both nitrogen and sulfur atoms. This compound features an aminoethyl side chain, contributing to its potential as a building block in pharmaceuticals and biochemistry. The thiazole moiety is known for its biological activity, often exhibiting antimicrobial and antifungal properties. The presence of amino groups enhances its reactivity, allowing for various chemical modifications. In terms of solubility, compounds of this nature are typically soluble in polar solvents due to the presence of amino groups, which can engage in hydrogen bonding. The compound's molecular structure suggests potential applications in medicinal chemistry, particularly in the development of new therapeutic agents. Additionally, its stability and reactivity can be influenced by environmental factors such as pH and temperature, making it important to consider these conditions in practical applications. Overall, 4-(2-aminoethyl)-1,3-thiazol-2-amine represents a versatile compound with significant implications in chemical and pharmaceutical research.
Formula:C5H9N3S
InChI:InChI=1/C5H9N3S/c6-2-1-4-3-9-5(7)8-4/h3H,1-2,6H2,(H2,7,8)
SMILES:C(CN)c1csc(=N)[nH]1
Synonyms:- 4-Thiazoleethanamine, 2-Amino-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
