CAS 124458-31-7
:Pyrido[4,3-d]pyrimidin-2-amine, 5,6,7,8-tetrahydro- (9CI)
Description:
Pyrido[4,3-d]pyrimidin-2-amine, 5,6,7,8-tetrahydro- is a heterocyclic organic compound characterized by a fused bicyclic structure that incorporates both pyridine and pyrimidine rings. This compound features a tetrahydro configuration, indicating the presence of four hydrogen atoms that saturate the ring system, contributing to its stability and reactivity. The amine functional group at the 2-position enhances its potential for hydrogen bonding and reactivity in various chemical reactions. This compound is often studied for its biological activity, particularly in medicinal chemistry, where it may exhibit properties relevant to drug development. Its structural characteristics suggest potential interactions with biological targets, making it a candidate for further research in pharmacology. Additionally, the presence of nitrogen atoms in the ring systems can influence its electronic properties, solubility, and overall behavior in different solvents. As with many heterocycles, the compound's unique structure may lead to diverse applications in organic synthesis and material science.
Formula:C7H10N4
InChI:InChI=1/C7H10N4/c8-7-10-4-5-3-9-2-1-6(5)11-7/h4,9H,1-3H2,(H2,8,10,11)
SMILES:C1CNCc2c[nH]c(=N)nc12
Synonyms:- Pyrido[4,3-D]Pyrimidin-2-Amine, 5,6,7,8-Tetrahydro-
- 5,6,7,8-Tetrahydro-pyrido[4,3-e][1,2,4]triazin-3-ylamine
- 5,6,7,8-Tetrahydropyrido[4,3-D]Pyrimidin-2-Amine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
