CymitQuimica logo

CAS 124461-28-5

:

2-Bromo-N-methyl-N-(phenylmethyl)benzamide

Description:
2-Bromo-N-methyl-N-(phenylmethyl)benzamide is a chemical compound characterized by its structural features, which include a bromine atom attached to a benzamide moiety. The presence of the N-methyl and N-(phenylmethyl) substituents indicates that the compound has both a methyl group and a phenylmethyl group attached to the nitrogen atom of the amide functional group. This structure contributes to its potential reactivity and solubility properties. The bromine atom can serve as a site for nucleophilic substitution reactions, making the compound useful in various synthetic applications. Additionally, the presence of the aromatic rings may impart certain stability and influence the compound's interactions with biological systems. The compound's molecular weight, melting point, and solubility characteristics would typically be determined through experimental methods, and its safety profile would need to be assessed due to the presence of bromine, which can be hazardous. Overall, 2-Bromo-N-methyl-N-(phenylmethyl)benzamide is a compound of interest in organic synthesis and medicinal chemistry.
Formula:C15H14BrNO
InChI:InChI=1S/C15H14BrNO/c1-17(11-12-7-3-2-4-8-12)15(18)13-9-5-6-10-14(13)16/h2-10H,11H2,1H3
InChI key:InChIKey=CGYAEGNOMBJVDQ-UHFFFAOYSA-N
SMILES:C(N(CC1=CC=CC=C1)C)(=O)C2=C(Br)C=CC=C2
Synonyms:
  • 2-Bromo-N-methyl-N-(phenylmethyl)benzamide
  • Benzamide, 2-bromo-N-methyl-N-(phenylmethyl)-
  • N-Benzyl-N-methyl 2-bromobenzamide
  • N-Benzyl-2-bromo-N-methylbenzamide
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.