CAS 124473-15-0
:6-Methoxy-2-[[(4-methoxy-3-methyl-2-pyridinyl)methyl]sulfinyl]-1H-benzimidazole
Description:
6-Methoxy-2-[[(4-methoxy-3-methyl-2-pyridinyl)methyl]sulfinyl]-1H-benzimidazole, with the CAS number 124473-15-0, is a chemical compound characterized by its complex structure, which includes a benzimidazole core substituted with a methoxy group and a sulfinyl moiety linked to a pyridine derivative. This compound exhibits properties typical of benzimidazole derivatives, such as potential biological activity, including antimicrobial and anti-inflammatory effects. The presence of the methoxy and sulfinyl groups may enhance its solubility and reactivity, making it of interest in medicinal chemistry. Its molecular structure suggests that it may interact with biological targets, potentially influencing various biochemical pathways. The compound's specific applications and efficacy would depend on further pharmacological studies and evaluations. As with many synthetic organic compounds, safety and handling precautions are essential, given the potential for toxicity or reactivity. Overall, this compound represents a class of molecules that may have significant implications in drug development and therapeutic applications.
Formula:C16H17N3O3S
InChI:InChI=1S/C16H17N3O3S/c1-10-14(17-7-6-15(10)22-3)9-23(20)16-18-12-5-4-11(21-2)8-13(12)19-16/h4-8H,9H2,1-3H3,(H,18,19)
InChI key:InChIKey=QUEHXHJZFDUMCQ-UHFFFAOYSA-N
SMILES:S(CC1=C(C)C(OC)=CC=N1)(=O)C=2NC=3C(N2)=CC=C(OC)C3
Synonyms:- 1H-Benzimidazole, 6-methoxy-2-[[(4-methoxy-3-methyl-2-pyridinyl)methyl]sulfinyl]-
- H 215/69
- 6-Methoxy-2-[[(4-methoxy-3-methyl-2-pyridinyl)methyl]sulfinyl]-1H-benzimidazole
- 1H-Benzimidazole, 5-methoxy-2-[[(4-methoxy-3-methyl-2-pyridinyl)methyl]sulfinyl]-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
