CAS 124476-80-8
:2-AMINO-1-(4-CHLORO-PHENYL)-5-OXO-4,5-DIHYDRO-1H-PYRROLE-3-CARBONITRILE
Description:
2-Amino-1-(4-chloro-phenyl)-5-oxo-4,5-dihydro-1H-pyrrole-3-carbonitrile, with the CAS number 124476-80-8, is a chemical compound characterized by its complex structure, which includes a pyrrole ring, an amino group, and a carbonitrile functional group. This compound typically exhibits properties associated with heterocyclic compounds, including potential biological activity due to the presence of the amino and carbonitrile groups. The 4-chloro-phenyl substituent may contribute to its lipophilicity and influence its interaction with biological targets. The presence of the carbonitrile group suggests potential reactivity, making it a candidate for further chemical transformations. Additionally, the compound may exhibit specific solubility characteristics depending on the solvent used, and its stability can be influenced by environmental factors such as pH and temperature. Overall, this compound may have applications in medicinal chemistry and material science, warranting further investigation into its properties and potential uses.
Formula:C11H8ClN3O
InChI:InChI=1/C11H8ClN3O/c12-8-1-3-9(4-2-8)15-10(16)5-7(6-13)11(15)14/h1-4H,5,14H2
SMILES:c1cc(ccc1Cl)N1C(=O)CC(=C1N)C#N
Synonyms:- 1H-Pyrrole-3-carbonitrile, 2-amino-1-(4-chlorophenyl)-4,5-dihydro-5-oxo-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
2-amino-1-(4-chlorophenyl)-5-oxo-4,5-dihydro-1H-pyrrole-3-carbonitrile
CAS:Formula:C11H8ClN3OMolecular weight:233.6537
