
CAS 1244761-68-9
:2-Chloro-5-cyclopropylpyrazine
Description:
2-Chloro-5-cyclopropylpyrazine is a heterocyclic organic compound characterized by its pyrazine ring, which is a six-membered aromatic ring containing two nitrogen atoms at non-adjacent positions. The presence of a chlorine atom at the second position and a cyclopropyl group at the fifth position contributes to its unique chemical properties. This compound is typically colorless to pale yellow and may exhibit a distinct odor. It is soluble in organic solvents and has limited solubility in water, which is common for many pyrazine derivatives. The chlorine substituent can influence its reactivity, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the cyclopropyl group can impart strain and unique steric effects, affecting the compound's overall stability and reactivity. 2-Chloro-5-cyclopropylpyrazine may find applications in pharmaceuticals, agrochemicals, or as a building block in organic synthesis due to its structural features and potential biological activity. Safety data should be consulted for handling and usage, as with any chemical substance.
Formula:C7H7ClN2
InChI:InChI=1S/C7H7ClN2/c8-7-4-9-6(3-10-7)5-1-2-5/h3-5H,1-2H2
InChI key:InChIKey=WRPIXGMYHHGDNH-UHFFFAOYSA-N
SMILES:ClC=1N=CC(C2CC2)=NC1
Synonyms:- 2-Chloro-5-cyclopropylpyrazine
- Pyrazine, 2-chloro-5-cyclopropyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.