CymitQuimica logo

CAS 1244855-37-5

:

3-[3-(2-Methylpropyl)-3H-imidazo[4,5-b]pyridin-2-yl]benzoic acid

Description:
3-[3-(2-Methylpropyl)-3H-imidazo[4,5-b]pyridin-2-yl]benzoic acid is a chemical compound characterized by its complex structure, which includes an imidazopyridine moiety and a benzoic acid functional group. This compound typically exhibits properties associated with both aromatic and heterocyclic compounds, contributing to its potential biological activity. The presence of the benzoic acid group suggests acidity, while the imidazopyridine structure may impart unique electronic and steric properties, influencing its interactions in biological systems. Such compounds are often investigated for their pharmacological potential, including roles as enzyme inhibitors or receptor modulators. The 2-methylpropyl substituent enhances lipophilicity, which can affect solubility and permeability in biological membranes. Overall, this compound's characteristics make it a subject of interest in medicinal chemistry and drug development, particularly in the context of targeting specific biological pathways or conditions. Further studies would be necessary to elucidate its specific applications and mechanisms of action.
Formula:C17H17N3O2
InChI:InChI=1S/C17H17N3O2/c1-11(2)10-20-15(19-14-7-4-8-18-16(14)20)12-5-3-6-13(9-12)17(21)22/h3-9,11H,10H2,1-2H3,(H,21,22)
InChI key:InChIKey=SKEJJCBCWZVUBY-UHFFFAOYSA-N
SMILES:C(C(C)C)N1C(=NC=2C1=NC=CC2)C3=CC(C(O)=O)=CC=C3
Synonyms:
  • Benzoic acid, 3-[3-(2-methylpropyl)-3H-imidazo[4,5-b]pyridin-2-yl]-
  • 3-[3-(2-Methylpropyl)-3H-imidazo[4,5-b]pyridin-2-yl]benzoic acid
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.