CAS 1244855-63-7
:2-[(2,3-Dimethylphenyl)dimethylsilyl]benzenemethanol
Description:
2-[(2,3-Dimethylphenyl)dimethylsilyl]benzenemethanol, identified by its CAS number 1244855-63-7, is an organosilicon compound characterized by the presence of a dimethylsilyl group attached to a phenyl ring that is further substituted with a benzenemethanol moiety. This compound features a complex structure that includes aromatic rings, which typically contribute to its stability and potential for various chemical interactions. The dimethylsilyl group enhances its hydrophobic properties and may influence its solubility in organic solvents. Additionally, the presence of hydroxyl (-OH) functional groups in the benzenemethanol part of the molecule can impart polar characteristics, allowing for hydrogen bonding and potential reactivity in various chemical environments. Such compounds may find applications in materials science, pharmaceuticals, or as intermediates in organic synthesis due to their unique structural features and functional groups. However, specific properties such as melting point, boiling point, and reactivity would require empirical data for precise characterization.
Formula:C17H22OSi
InChI:InChI=1S/C17H22OSi/c1-13-8-7-11-16(14(13)2)19(3,4)17-10-6-5-9-15(17)12-18/h5-11,18H,12H2,1-4H3
InChI key:InChIKey=BUSBGSPSZKWUNJ-UHFFFAOYSA-N
SMILES:[Si](C)(C)(C1=C(CO)C=CC=C1)C2=C(C)C(C)=CC=C2
Synonyms:- Benzenemethanol, 2-[(2,3-dimethylphenyl)dimethylsilyl]-
- 2-[(2,3-Dimethylphenyl)dimethylsilyl]benzenemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.