CAS 1244855-64-8
:2-[Dimethyl[4-(1-piperidinylmethyl)phenyl]silyl]benzenemethanol
Description:
2-[Dimethyl[4-(1-piperidinylmethyl)phenyl]silyl]benzenemethanol, with the CAS number 1244855-64-8, is a chemical compound characterized by its complex structure that includes a silane group, a piperidine moiety, and a phenolic component. This compound features a silicon atom bonded to two methyl groups and a phenyl ring, which is further substituted with a piperidinylmethyl group. The presence of the hydroxyl (-OH) group indicates that it exhibits alcohol characteristics, which can influence its solubility and reactivity. The piperidine ring contributes to its potential biological activity, making it of interest in medicinal chemistry. The compound's unique structure may impart specific properties such as lipophilicity and the ability to engage in hydrogen bonding, which are crucial for interactions with biological targets. Overall, this compound's characteristics suggest potential applications in pharmaceuticals or materials science, although specific properties such as melting point, boiling point, and solubility would require empirical determination.
Formula:C21H29NOSi
InChI:InChI=1S/C21H29NOSi/c1-24(2,21-9-5-4-8-19(21)17-23)20-12-10-18(11-13-20)16-22-14-6-3-7-15-22/h4-5,8-13,23H,3,6-7,14-17H2,1-2H3
InChI key:InChIKey=ZBRCPFLGGWGNOD-UHFFFAOYSA-N
SMILES:[Si](C)(C)(C1=C(CO)C=CC=C1)C2=CC=C(CN3CCCCC3)C=C2
Synonyms:- Benzenemethanol, 2-[dimethyl[4-(1-piperidinylmethyl)phenyl]silyl]-
- 2-[Dimethyl[4-(1-piperidinylmethyl)phenyl]silyl]benzenemethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.