
CAS 124491-43-6
:1-[2-(Ethylsulfonyl)-5-pyrimidinyl]ethanone
Description:
1-[2-(Ethylsulfonyl)-5-pyrimidinyl]ethanone, with the CAS number 124491-43-6, is a chemical compound characterized by its unique structure that includes a pyrimidine ring substituted with an ethylsulfonyl group and an ethanone moiety. This compound typically exhibits properties associated with both heterocyclic and sulfonyl-containing compounds, which may influence its solubility, reactivity, and biological activity. The presence of the pyrimidine ring suggests potential applications in pharmaceuticals, as pyrimidines are often found in various biologically active molecules. The ethylsulfonyl group may enhance the compound's solubility in polar solvents and could also play a role in its interaction with biological targets. Additionally, the compound's functional groups may contribute to its potential as a ligand or inhibitor in biochemical pathways. Overall, 1-[2-(Ethylsulfonyl)-5-pyrimidinyl]ethanone represents a class of compounds that may have significant implications in medicinal chemistry and drug development.
Formula:C8H10N2O3S
InChI:InChI=1S/C8H10N2O3S/c1-3-14(12,13)8-9-4-7(5-10-8)6(2)11/h4-5H,3H2,1-2H3
InChI key:InChIKey=SXWDEGNVFYYMFV-UHFFFAOYSA-N
SMILES:S(CC)(=O)(=O)C=1N=CC(C(C)=O)=CN1
Synonyms:- Ethanone, 1-[2-(ethylsulfonyl)-5-pyrimidinyl]-
- 1-[2-(Ethylsulfonyl)-5-pyrimidinyl]ethanone
- 1-[2-(Ethanesulfonyl)pyrimidin-5-yl]ethan-1-one
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.