CAS 124491-44-7
:5-Pyrimidinecarbonyl bromide, 2-amino-
Description:
5-Pyrimidinecarbonyl bromide, 2-amino- is an organic compound characterized by its pyrimidine ring structure, which is a six-membered heterocyclic aromatic ring containing two nitrogen atoms at positions 1 and 3. This compound features a carbonyl group (C=O) attached to the pyrimidine ring, along with a bromine atom, indicating its reactivity and potential use in various chemical reactions. The presence of the amino group (-NH2) at the 2-position enhances its nucleophilicity, making it a valuable intermediate in organic synthesis, particularly in the development of pharmaceuticals and agrochemicals. The compound is typically handled with caution due to its reactive nature, especially in the presence of moisture, which can lead to hydrolysis. Its physical properties, such as solubility and melting point, can vary based on the specific conditions and purity of the sample. Overall, 5-Pyrimidinecarbonyl bromide, 2-amino- is significant in synthetic organic chemistry for its versatile reactivity and potential applications.
Formula:C5H4BrN3O
InChI:InChI=1S/C5H4BrN3O/c6-4(10)3-1-8-5(7)9-2-3/h1-2H,(H2,7,8,9)
InChI key:InChIKey=XKYSQBJCKBYAHV-UHFFFAOYSA-N
SMILES:C(Br)(=O)C=1C=NC(N)=NC1
Synonyms:- 5-Pyrimidinecarbonyl bromide, 2-amino-
- 2-Aminopyrimidine-5-carbonyl bromide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
