
CAS 1244949-12-9
:2-Methoxy-5-(4-pyrimidinyl)benzoic acid
Description:
2-Methoxy-5-(4-pyrimidinyl)benzoic acid is an organic compound characterized by its aromatic structure, which includes a methoxy group and a pyrimidine ring. This compound features a benzoic acid moiety, indicating the presence of a carboxylic acid functional group, which contributes to its acidity and potential for hydrogen bonding. The methoxy group enhances the compound's solubility in organic solvents and may influence its reactivity and biological activity. The pyrimidine ring, a six-membered heterocyclic structure containing nitrogen atoms, can impart specific pharmacological properties, making this compound of interest in medicinal chemistry. Its molecular structure suggests potential applications in drug development, particularly in targeting specific biological pathways. Additionally, the presence of both electron-donating (methoxy) and electron-withdrawing (carboxylic acid) groups can affect the compound's electronic properties, influencing its interactions with biological targets. Overall, 2-Methoxy-5-(4-pyrimidinyl)benzoic acid is a versatile compound with potential applications in various fields, including pharmaceuticals and agrochemicals.
Formula:C12H10N2O3
InChI:InChI=1S/C12H10N2O3/c1-17-11-3-2-8(6-9(11)12(15)16)10-4-5-13-7-14-10/h2-7H,1H3,(H,15,16)
InChI key:InChIKey=BZSAHZMORVRKNI-UHFFFAOYSA-N
SMILES:C(O)(=O)C=1C=C(C=CC1OC)C=2C=CN=CN2
Synonyms:- 2-Methoxy-5-(4-pyrimidinyl)benzoic acid
- Benzoic acid, 2-methoxy-5-(4-pyrimidinyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.