CymitQuimica logo

CAS 1244949-20-9

:

Butanoic acid, 2-methoxy-3,3-dimethyl-, (2S)-

Description:
Butanoic acid, 2-methoxy-3,3-dimethyl-, (2S)-, with the CAS number 1244949-20-9, is an organic compound characterized by its carboxylic acid functional group and a branched alkyl structure. This compound features a butanoic acid backbone, which is a four-carbon chain, with a methoxy group (-OCH3) and two methyl groups (-CH3) attached to the third carbon. The presence of the stereocenter at the second carbon indicates that it exists in a specific chiral form, designated as (2S)-, which can influence its chemical behavior and interactions. Butanoic acid derivatives are known for their distinctive odors and are often used in flavoring and fragrance applications. Additionally, the presence of the methoxy group can enhance solubility in organic solvents and may affect the compound's reactivity. Overall, this substance is of interest in various fields, including organic synthesis and medicinal chemistry, due to its unique structural features and potential applications.
Formula:C7H14O3
InChI:InChI=1S/C7H14O3/c1-7(2,3)5(10-4)6(8)9/h5H,1-4H3,(H,8,9)/t5-/m1/s1
InChI key:InChIKey=URUCVJOSXWZMGA-RXMQYKEDSA-N
SMILES:[C@H](C(C)(C)C)(C(O)=O)OC
Synonyms:
  • (2S)-2-Methoxy-3,3-dimethylbutanoic acid
  • Butanoic acid, 2-methoxy-3,3-dimethyl-, (2S)-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.