CAS 1244949-68-5

4,6-Dichloro-2-pyrimidinemethanol

Description:

4,6-Dichloro-2-pyrimidinemethanol is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions. The presence of two chlorine atoms at the 4 and 6 positions of the ring contributes to its reactivity and potential applications in various chemical reactions. The hydroxymethyl group (-CH2OH) at the 2 position enhances its solubility in polar solvents and may influence its biological activity. This compound is often studied for its potential use in pharmaceuticals, particularly in the development of antiviral or anticancer agents, due to the biological significance of pyrimidine derivatives. Its molecular structure allows for various functionalization possibilities, making it a versatile intermediate in organic synthesis. Safety data should be consulted for handling, as halogenated compounds can pose health risks. Overall, 4,6-Dichloro-2-pyrimidinemethanol is an important compound in medicinal chemistry and organic synthesis.

Formula: C₅H₄Cl₂N₂O

InChI: InChI=1S/C5H4Cl2N2O/c6-3-1-4(7)9-5(2-10)8-3/h1,10H,2H2

InChI key: InChIKey=NYUNBUWGWXSQGF-UHFFFAOYSA-N

SMILES: C(O)C=1N=C(Cl)C=C(Cl)N1

Synonyms:

• 2-Pyrimidinemethanol, 4,6-dichloro-
• 4,6-Dichloro-2-pyrimidinemethanol

2-Pyrimidinemethanol, 4,6-dichloro-

CAS: 1244949-68-5

Formula: C₅H₄Cl₂N₂O

Purity: 97%

Color and Shape: Solid

Molecular weight: 179.0041

Ref: IN-DA000M3A

(4,6-Dichloropyrimidin-2-yl)methanol

CAS: 1244949-68-5

Formula: C₅H₄Cl₂N₂O

Purity: 97%

Molecular weight: 179

Ref: 10-F324313

4,6-Dichloro-2-pyrimidinemethanol

CAS: 1244949-68-5

Versatile small molecule scaffold

Formula: C₅H₄N₂OCl₂

Purity: Min. 95%

Molecular weight: 179 g/mol

Ref: 3D-UZB94968