CymitQuimica logo

CAS 1244949-71-0

:

Methyl 4-chloro-1H-pyrrolo[3,2-c]pyridine-6-carboxylate

Description:
Methyl 4-chloro-1H-pyrrolo[3,2-c]pyridine-6-carboxylate is a heterocyclic organic compound characterized by its pyrrolopyridine structure, which incorporates both pyridine and pyrrole rings. This compound features a methyl ester functional group, contributing to its reactivity and solubility properties. The presence of a chlorine atom at the 4-position of the pyrrole ring enhances its electrophilic character, making it a potential candidate for various chemical reactions, including nucleophilic substitutions. The carboxylate group provides acidity, which can influence its behavior in biological systems and chemical syntheses. Methyl 4-chloro-1H-pyrrolo[3,2-c]pyridine-6-carboxylate may exhibit interesting pharmacological properties, making it of interest in medicinal chemistry. Its unique structural features allow for potential applications in drug development, agrochemicals, and materials science. As with many heterocycles, the compound's stability, reactivity, and interactions with other molecules can be influenced by its electronic and steric properties, which are essential for understanding its behavior in various chemical contexts.
Formula:C9H7ClN2O2
InChI:InChI=1S/C9H7ClN2O2/c1-14-9(13)7-4-6-5(2-3-11-6)8(10)12-7/h2-4,11H,1H3
InChI key:InChIKey=FWVGFHICGCRVDI-UHFFFAOYSA-N
SMILES:ClC1=C2C(=CC(C(OC)=O)=N1)NC=C2
Synonyms:
  • Methyl 4-chloro-1H-pyrrolo[3,2-c]pyridine-6-carboxylate
  • 1H-Pyrrolo[3,2-c]pyridine-6-carboxylic acid, 4-chloro-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.