CymitQuimica logo

CAS 124495-31-4

:

8-Chloro-4-(2-chloro-4-fluorophenoxy)quinoline

Description:
8-Chloro-4-(2-chloro-4-fluorophenoxy)quinoline is a synthetic organic compound characterized by its quinoline backbone, which is a bicyclic structure containing a benzene ring fused to a pyridine ring. The presence of chlorine and fluorine substituents on the phenoxy group contributes to its chemical reactivity and potential biological activity. This compound is typically used in research and development, particularly in medicinal chemistry, due to its potential as a pharmacological agent. Its molecular structure suggests it may exhibit properties such as antimicrobial or anticancer activity, although specific biological effects would depend on further empirical studies. The compound is likely to be soluble in organic solvents and may have moderate stability under standard laboratory conditions. Safety data should be consulted for handling and disposal, as halogenated compounds can pose environmental and health risks. Overall, 8-Chloro-4-(2-chloro-4-fluorophenoxy)quinoline represents a class of compounds that are of interest for their potential applications in drug discovery and development.
Formula:C15H8Cl2FNO
InChI:InChI=1/C15H8Cl2FNO/c16-11-3-1-2-10-13(6-7-19-15(10)11)20-14-5-4-9(18)8-12(14)17/h1-8H
SMILES:c1cc2c(ccnc2c(c1)Cl)Oc1ccc(cc1Cl)F
Synonyms:
  • Ly 214352
  • Ly214352
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 2 products.