CAS 1244964-06-4

3-(Difluoromethyl)-1-(2-methylpropyl)-1H-pyrazole-4-carboxylic acid

Description:

3-(Difluoromethyl)-1-(2-methylpropyl)-1H-pyrazole-4-carboxylic acid is a chemical compound characterized by its unique pyrazole structure, which includes a difluoromethyl group and a branched alkyl substituent. This compound features a carboxylic acid functional group, contributing to its acidity and potential reactivity in various chemical reactions. The presence of the difluoromethyl group enhances its lipophilicity and may influence its biological activity, making it of interest in medicinal chemistry. The 2-methylpropyl group adds steric bulk, which can affect the compound's interaction with biological targets. Overall, this compound's structural features suggest potential applications in pharmaceuticals, particularly in the development of new therapeutic agents. Its specific properties, such as solubility, melting point, and stability, would depend on the molecular interactions and the environment in which it is studied. Further research would be necessary to fully elucidate its characteristics and potential applications in various fields.

Formula: C₉H₁₂F₂N₂O₂

InChI: InChI=1S/C9H12F2N2O2/c1-5(2)3-13-4-6(9(14)15)7(12-13)8(10)11/h4-5,8H,3H2,1-2H3,(H,14,15)

InChI key: InChIKey=SNDFTWQSHNOENR-UHFFFAOYSA-N

SMILES: C(O)(=O)C=1C(C(F)F)=NN(CC(C)C)C1

Synonyms:

• 1H-Pyrazole-4-carboxylic acid, 3-(difluoromethyl)-1-(2-methylpropyl)-
• 3-(Difluoromethyl)-1-(2-methylpropyl)-1H-pyrazole-4-carboxylic acid

3-(Difluoromethyl)-1-(2-methylpropyl)-1H-pyrazole-4-carboxylic acid

CAS: 1244964-06-4

Versatile small molecule scaffold

Formula: C₉H₁₂F₂N₂O₂

Purity: Min. 95%

Molecular weight: 218.2 g/mol

Ref: 3D-UZB96406