CymitQuimica logo

CAS 124499-30-5

:

4-(2-Cyclohexylethenyl)benzeneethanamine

Description:
4-(2-Cyclohexylethenyl)benzeneethanamine, identified by its CAS number 124499-30-5, is an organic compound characterized by its unique structure that includes a benzene ring, an ethylene bridge, and an amine functional group. This compound features a cyclohexyl group attached to the ethylene moiety, which contributes to its hydrophobic characteristics and potential for various interactions in biological systems. The presence of the amine group suggests that it may exhibit basic properties and could participate in hydrogen bonding, influencing its solubility and reactivity. Additionally, the compound's structural features may allow it to engage in π-π stacking interactions due to the aromatic benzene ring, which can be significant in applications such as drug design or materials science. Its specific physical and chemical properties, such as melting point, boiling point, and reactivity, would depend on the molecular interactions and the environment in which it is studied. Overall, this compound's unique structure positions it as a candidate for further research in various chemical and pharmaceutical applications.
Formula:C16H23N
InChI:InChI=1S/C16H23N/c17-13-12-16-10-8-15(9-11-16)7-6-14-4-2-1-3-5-14/h6-11,14H,1-5,12-13,17H2
InChI key:InChIKey=WLYDHKGNJKKYEZ-UHFFFAOYSA-N
SMILES:C(=CC1CCCCC1)C2=CC=C(CCN)C=C2
Synonyms:
  • Benzeneethanamine, 4-(2-cyclohexylethenyl)-
  • 2-[4-(2-Cyclohexyl-vinyl)-phenyl]-ethylamine
  • 4-(2-Cyclohexylethenyl)benzeneethanamine
  • 2-[4-(2-Cyclohexylethenyl)phenyl]ethanamine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.