CAS 124499-31-6
:4-(2-Cyclohexylethyl)benzeneethanamine
Description:
4-(2-Cyclohexylethyl)benzeneethanamine, identified by its CAS number 124499-31-6, is an organic compound characterized by its structure, which features a benzene ring substituted with an ethylamine group and a cyclohexyl group. This compound belongs to the class of amines and is known for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals. Its molecular structure suggests it may exhibit hydrophobic properties due to the presence of the cyclohexyl group, which can influence its solubility and interaction with biological membranes. Additionally, the amine functional group can participate in hydrogen bonding, affecting its reactivity and biological activity. The compound's characteristics, such as melting point, boiling point, and specific reactivity, would depend on its purity and the conditions under which it is studied. Overall, 4-(2-Cyclohexylethyl)benzeneethanamine is of interest for its potential therapeutic applications and its role in the synthesis of more complex organic molecules.
Formula:C16H25N
InChI:InChI=1S/C16H25N/c17-13-12-16-10-8-15(9-11-16)7-6-14-4-2-1-3-5-14/h8-11,14H,1-7,12-13,17H2
InChI key:InChIKey=IFWGVWBAKRWCQH-UHFFFAOYSA-N
SMILES:C(CC1CCCCC1)C2=CC=C(CCN)C=C2
Synonyms:- 4-(2-Cyclohexylethyl)benzeneethanamine
- 2-[4-(2-Cyclohexylethyl)phenyl]ethanamine
- 2-[4-(2-Cyclohexyl-ethyl)-phenyl]-ethylamine
- Benzeneethanamine, 4-(2-cyclohexylethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
