CAS 1245010-20-1

Methyl 2-[(dimethylamino)methylene]-3-oxopentanoate

Description:

Methyl 2-[(dimethylamino)methylene]-3-oxopentanoate, identified by its CAS number 1245010-20-1, is an organic compound characterized by its ester functional group and a ketone moiety. This compound features a methyl ester, which contributes to its solubility in organic solvents and potential reactivity in various chemical reactions. The presence of a dimethylamino group indicates that it may exhibit basic properties and can participate in nucleophilic reactions. The structure suggests that it may be involved in synthetic pathways, particularly in the formation of more complex molecules. Additionally, the compound may have applications in medicinal chemistry or as an intermediate in organic synthesis due to its functional groups. Its stability, reactivity, and specific applications would depend on the conditions under which it is used, including temperature, solvent, and the presence of other reagents. As with many organic compounds, safety data should be consulted to understand its handling and potential hazards.

Formula: C₉H₁₅NO₃

InChI: InChI=1S/C9H15NO3/c1-5-8(11)7(6-10(2)3)9(12)13-4/h6H,5H2,1-4H3

InChI key: InChIKey=QSOGGNJSTUMNFI-UHFFFAOYSA-N

SMILES: C(C(CC)=O)(C(OC)=O)=CN(C)C

Synonyms:

• Methyl 2-[(dimethylamino)methylene]-3-oxopentanoate
• Pentanoic acid, 2-[(dimethylamino)methylene]-3-oxo-, methyl ester