CymitQuimica logo

CAS 1245101-35-2

:

Ethyl 5-bromo-1-(2-fluorophenyl)-1H-pyrazole-4-carboxylate

Description:
Ethyl 5-bromo-1-(2-fluorophenyl)-1H-pyrazole-4-carboxylate is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a bromine atom at the 5-position and a fluorophenyl group at the 1-position contributes to its unique reactivity and potential biological activity. The ethyl ester functional group at the 4-position enhances its solubility in organic solvents, making it suitable for various applications in organic synthesis and medicinal chemistry. This compound may exhibit interesting pharmacological properties due to the presence of halogen substituents, which can influence its interaction with biological targets. Additionally, the structural features suggest potential use in the development of agrochemicals or pharmaceuticals. As with many pyrazole derivatives, it may also be involved in various chemical reactions, including nucleophilic substitutions and coupling reactions, making it a versatile intermediate in synthetic chemistry. Safety and handling precautions should be observed, as with all chemical substances, due to potential toxicity or reactivity.
Formula:C12H10BrFN2O2
InChI:InChI=1S/C12H10BrFN2O2/c1-2-18-12(17)8-7-15-16(11(8)13)10-6-4-3-5-9(10)14/h3-7H,2H2,1H3
InChI key:InChIKey=NXPIHJAGSXXVPI-UHFFFAOYSA-N
SMILES:BrC=1N(N=CC1C(OCC)=O)C2=C(F)C=CC=C2
Synonyms:
  • 1H-Pyrazole-4-carboxylic acid, 5-bromo-1-(2-fluorophenyl)-, ethyl ester
  • Ethyl 5-bromo-1-(2-fluorophenyl)-1H-pyrazole-4-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.