
CAS 1245215-48-8
:Methyl 4-hydroxy-2-methyl-2H-indazole-6-carboxylate
Description:
Methyl 4-hydroxy-2-methyl-2H-indazole-6-carboxylate, identified by its CAS number 1245215-48-8, is a chemical compound characterized by its indazole core structure, which features a hydroxyl group and a carboxylate ester functional group. This compound typically exhibits properties associated with indazole derivatives, such as potential biological activity, including anti-inflammatory or analgesic effects, although specific biological data may vary. The presence of the methyl group and hydroxyl group can influence its solubility and reactivity, making it of interest in medicinal chemistry and drug development. The compound's molecular structure suggests it may participate in hydrogen bonding due to the hydroxyl group, which can affect its interactions with biological targets. Additionally, the carboxylate moiety may enhance its polarity, influencing its pharmacokinetic properties. Overall, Methyl 4-hydroxy-2-methyl-2H-indazole-6-carboxylate represents a class of compounds that may have significant implications in pharmaceutical research and development.
Formula:C10H10N2O3
InChI:InChI=1S/C10H10N2O3/c1-12-5-7-8(11-12)3-6(4-9(7)13)10(14)15-2/h3-5,13H,1-2H3
InChI key:InChIKey=ULHABDDGDNFKDY-UHFFFAOYSA-N
SMILES:OC=1C=2C(C=C(C(OC)=O)C1)=NN(C)C2
Synonyms:- Methyl 4-hydroxy-2-methyl-2H-indazole-6-carboxylate
- 2H-Indazole-6-carboxylic acid, 4-hydroxy-2-methyl-, methyl ester
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.