CAS 1245215-49-9

Methyl 2-ethyl-4-methoxy-2H-indazole-6-carboxylate

Description:

Methyl 2-ethyl-4-methoxy-2H-indazole-6-carboxylate is a chemical compound characterized by its indazole core, which is a bicyclic structure containing a five-membered ring fused to a six-membered ring. This compound features a carboxylate functional group, which contributes to its acidity and reactivity, as well as an ethyl group and a methoxy group that enhance its lipophilicity and influence its solubility in organic solvents. The presence of the methoxy group can also affect the compound's electronic properties, potentially making it a candidate for various chemical reactions or applications in medicinal chemistry. The specific arrangement of substituents on the indazole ring can impart unique biological activities, making it of interest in pharmaceutical research. Additionally, the compound's molecular structure suggests potential for interactions with biological targets, which may lead to therapeutic applications. As with many organic compounds, its stability, reactivity, and potential uses would depend on the specific conditions under which it is handled and studied.

Formula: C₁₂H₁₄N₂O₃

InChI: InChI=1S/C12H14N2O3/c1-4-14-7-9-10(13-14)5-8(12(15)17-3)6-11(9)16-2/h5-7H,4H2,1-3H3

InChI key: InChIKey=FRCUUKKZWYSRAK-UHFFFAOYSA-N

SMILES: O(C)C=1C=2C(C=C(C(OC)=O)C1)=NN(CC)C2

Synonyms:

• 2H-Indazole-6-carboxylic acid, 2-ethyl-4-methoxy-, methyl ester
• Methyl 2-ethyl-4-methoxy-2H-indazole-6-carboxylate