CAS 1245215-52-4

Ethyl 4-methoxy-1H-indazole-6-carboxylate

Description:

Ethyl 4-methoxy-1H-indazole-6-carboxylate is a chemical compound characterized by its indazole core, which is a five-membered heterocyclic structure containing two nitrogen atoms. This compound features an ethyl ester functional group, contributing to its solubility and reactivity. The presence of a methoxy group at the 4-position of the indazole ring enhances its electronic properties and may influence its biological activity. The carboxylate group at the 6-position is significant for potential interactions in various chemical reactions, including esterification and amidation. Ethyl 4-methoxy-1H-indazole-6-carboxylate is of interest in medicinal chemistry and drug development due to its potential pharmacological properties. Its structural characteristics suggest it may exhibit diverse biological activities, making it a candidate for further research in therapeutic applications. As with many organic compounds, its stability, reactivity, and interactions with other substances can vary based on environmental conditions such as pH, temperature, and solvent.

Formula: C₁₁H₁₂N₂O₃

InChI: InChI=1S/C11H12N2O3/c1-3-16-11(14)7-4-9-8(6-12-13-9)10(5-7)15-2/h4-6H,3H2,1-2H3,(H,12,13)

InChI key: InChIKey=OVHGUCGUIXWUBS-UHFFFAOYSA-N

SMILES: O(C)C1=C2C(=CC(C(OCC)=O)=C1)NN=C2

Synonyms:

• 1H-Indazole-6-carboxylic acid, 4-methoxy-, ethyl ester
• Ethyl 4-methoxy-1H-indazole-6-carboxylate