CymitQuimica logo

CAS 1245258-74-5

:

Ethyl 5-bromo-1-(4-nitrophenyl)-1H-pyrazole-4-carboxylate

Description:
Ethyl 5-bromo-1-(4-nitrophenyl)-1H-pyrazole-4-carboxylate is a chemical compound characterized by its pyrazole core, which is a five-membered ring containing two nitrogen atoms. The presence of a bromine atom at the 5-position and a nitrophenyl group at the 1-position contributes to its unique reactivity and potential applications in organic synthesis and medicinal chemistry. The ethyl ester functional group at the 4-position enhances its solubility in organic solvents, making it suitable for various chemical reactions. This compound may exhibit biological activity due to the nitro group, which can influence its interaction with biological targets. Additionally, the structural features suggest potential use in the development of agrochemicals or pharmaceuticals. Its molecular structure allows for various substitution reactions, making it a versatile intermediate in synthetic chemistry. As with many brominated compounds, it is essential to handle it with care due to potential environmental and health impacts.
Formula:C12H10BrN3O4
InChI:InChI=1S/C12H10BrN3O4/c1-2-20-12(17)10-7-14-15(11(10)13)8-3-5-9(6-4-8)16(18)19/h3-7H,2H2,1H3
InChI key:InChIKey=RLYVZWLOYJUQDT-UHFFFAOYSA-N
SMILES:BrC=1N(N=CC1C(OCC)=O)C2=CC=C(N(=O)=O)C=C2
Synonyms:
  • 1H-Pyrazole-4-carboxylic acid, 5-bromo-1-(4-nitrophenyl)-, ethyl ester
  • Ethyl 5-bromo-1-(4-nitrophenyl)-1H-pyrazole-4-carboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.