CAS 124529-03-9
:N-(2,2-Dimethyl-1-oxopropyl)-L-cysteine
Description:
N-(2,2-Dimethyl-1-oxopropyl)-L-cysteine, identified by its CAS number 124529-03-9, is an amino acid derivative that features a cysteine backbone modified with a 2,2-dimethyl-1-oxopropyl group. This compound is characterized by the presence of a thiol (-SH) group, which is typical of cysteine, allowing it to participate in redox reactions and form disulfide bonds, crucial for protein structure and function. The oxopropyl group introduces steric hindrance due to its branched structure, potentially influencing the compound's reactivity and interaction with biological systems. This modification may also affect the solubility and stability of the molecule in various environments. N-(2,2-Dimethyl-1-oxopropyl)-L-cysteine may have applications in biochemical research, particularly in studies involving protein folding, enzyme activity, and the synthesis of peptides. As with many amino acid derivatives, its properties can be influenced by pH, temperature, and the presence of other ions or molecules in solution.
Formula:C8H15NO3S
InChI:InChI=1S/C8H15NO3S/c1-8(2,3)7(12)9-5(4-13)6(10)11/h5,13H,4H2,1-3H3,(H,9,12)(H,10,11)/t5-/m0/s1
InChI key:InChIKey=NKIKSSZMMDDQRL-YFKPBYRVSA-N
SMILES:[C@@H](NC(C(C)(C)C)=O)(C(O)=O)CS
Synonyms:- N-(2,2-Dimethyl-1-oxopropyl)-L-cysteine
- L-Cysteine, N-(2,2-dimethyl-1-oxopropyl)-
- (2R)-2-(2,2-Dimethylpropanamido)-3-sulfanylpropanoic acid
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
