
CAS 1245321-32-7
:α-[4-(Trifluoromethyl)phenyl]-2-furanmethanol
Description:
α-[4-(Trifluoromethyl)phenyl]-2-furanmethanol is an organic compound characterized by its unique structure, which includes a furan ring and a trifluoromethyl-substituted phenyl group. The presence of the trifluoromethyl group enhances its lipophilicity and can influence its reactivity and biological activity. This compound typically exhibits properties such as moderate solubility in organic solvents and potential applications in pharmaceuticals or agrochemicals due to its functional groups. The furan moiety contributes to its aromatic characteristics, while the hydroxymethyl group can participate in hydrogen bonding, affecting its interaction with other molecules. Additionally, the trifluoromethyl group is known for imparting unique electronic properties, which can enhance the compound's stability and reactivity in various chemical reactions. Overall, α-[4-(Trifluoromethyl)phenyl]-2-furanmethanol is a compound of interest in synthetic chemistry and material science, with potential implications in drug design and development.
Formula:C12H9F3O2
InChI:InChI=1S/C12H9F3O2/c13-12(14,15)9-5-3-8(4-6-9)11(16)10-2-1-7-17-10/h1-7,11,16H
InChI key:InChIKey=NLJWQZQAAKTHAK-UHFFFAOYSA-N
SMILES:C(O)(C1=CC=C(C(F)(F)F)C=C1)C2=CC=CO2
Synonyms:- 2-Furanmethanol, α-[4-(trifluoromethyl)phenyl]-
- (Furan-2-yl)[4-(trifluoromethyl)phenyl]methanol
- α-[4-(Trifluoromethyl)phenyl]-2-furanmethanol
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 0 products.