CAS 124549-23-1
:pbfi-am
Description:
The chemical substance known as "pbfi-am," with the CAS number 124549-23-1, is a specific compound that may not be widely recognized in general chemical literature. However, based on its designation, it likely contains elements such as lead (Pb) and fluorine (F), suggesting potential applications in fields like materials science or electronics. Compounds with lead can exhibit unique properties, including high density and potential conductivity, while fluorinated compounds often demonstrate enhanced stability and resistance to chemical degradation. The "am" in its name may indicate an amine or amide functional group, which could impart specific reactivity or solubility characteristics. As with any lead-containing compound, safety and environmental considerations are paramount due to lead's toxicity. Therefore, handling and disposal must adhere to regulatory guidelines. For detailed properties, applications, and safety data, consulting specialized databases or scientific literature is recommended, as this compound may have niche applications or be of interest in specific research contexts.
Formula:C58H62N2O24
InChI:InChI=1/C58H62N2O24/c1-35(61)75-31-79-55(65)39-7-9-43(45(23-39)57(67)81-33-77-37(3)63)51-25-41-27-53(69-5)47(29-49(41)83-51)59-11-15-71-19-21-73-17-13-60(14-18-74-22-20-72-16-12-59)48-30-50-42(28-54(48)70-6)26-52(84-50)44-10-8-40(56(66)80-32-76-36(2)62)24-46(44)58(68)82-34-78-38(4)64/h7-10,23-30H,11-22,31-34H2,1-6H3
SMILES:CC(=O)OCOC(=O)c1ccc(c(c1)C(=O)OCOC(=O)C)c1cc2cc(c(cc2o1)N1CCOCCOCCN(CCOCCOCC1)c1cc2c(cc(c3ccc(cc3C(=O)OCOC(=O)C)C(=O)OCOC(=O)C)o2)cc1OC)OC
Synonyms:- Tetrakis[(Acetyloxy)Methyl] 4,4'-[1,4,10,13-Tetraoxa-7,16-Diazacyclooctadecane-7,16-Diylbis(5-Methoxy-1-Benzofuran-6,2-Diyl)]Dibenzene-1,3-Dicarboxylate
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.



