CAS 1245536-24-6

3-(1-Methylethyl)-1,2,4-oxadiazole-5-acetamide

Description:

3-(1-Methylethyl)-1,2,4-oxadiazole-5-acetamide is a chemical compound characterized by its unique oxadiazole ring structure, which contributes to its potential biological activity. The presence of the 1-methylethyl group enhances its lipophilicity, potentially influencing its solubility and permeability in biological systems. The acetamide functional group may impart polar characteristics, affecting its interactions with other molecules. This compound is likely to exhibit properties typical of oxadiazoles, such as antimicrobial or antifungal activities, although specific biological data would be necessary to confirm these effects. Its molecular structure suggests it could participate in hydrogen bonding due to the amide group, which may play a role in its reactivity and interactions with biological targets. The compound's CAS number, 1245536-24-6, allows for precise identification in chemical databases, facilitating research and application in various fields, including medicinal chemistry and materials science. Further studies would be essential to elucidate its full range of properties and potential applications.

Formula: C₇H₁₁N₃O₂

InChI: InChI=1S/C7H11N3O2/c1-4(2)7-9-6(12-10-7)3-5(8)11/h4H,3H2,1-2H3,(H2,8,11)

InChI key: InChIKey=SNSXKXUIWINRHH-UHFFFAOYSA-N

SMILES: C(C(N)=O)C1=NC(C(C)C)=NO1

Synonyms:

• 3-(1-Methylethyl)-1,2,4-oxadiazole-5-acetamide
• 1,2,4-Oxadiazole-5-acetamide, 3-(1-methylethyl)-