CAS 1245563-08-9
:5-Bromo-N-(2,2,2-trifluoroethyl)-2-pyrimidinamine
Description:
5-Bromo-N-(2,2,2-trifluoroethyl)-2-pyrimidinamine is a chemical compound characterized by its pyrimidine ring structure, which is a six-membered aromatic ring containing two nitrogen atoms at the 1 and 3 positions. The presence of a bromine atom at the 5-position of the pyrimidine ring contributes to its reactivity and potential applications in various chemical reactions. The N-(2,2,2-trifluoroethyl) substituent introduces significant fluorine content, which can enhance the compound's lipophilicity and influence its biological activity. This compound may exhibit interesting pharmacological properties, making it a candidate for research in medicinal chemistry. Its unique combination of halogenated groups can also affect its stability and solubility in different solvents. As with many halogenated compounds, it is essential to consider environmental and safety aspects during handling and disposal. Overall, 5-Bromo-N-(2,2,2-trifluoroethyl)-2-pyrimidinamine represents a valuable structure for further exploration in chemical synthesis and potential therapeutic applications.
Formula:C6H5BrF3N3
InChI:InChI=1S/C6H5BrF3N3/c7-4-1-11-5(12-2-4)13-3-6(8,9)10/h1-2H,3H2,(H,11,12,13)
InChI key:InChIKey=XAHKWJXWKQLGSJ-UHFFFAOYSA-N
SMILES:N(CC(F)(F)F)C=1N=CC(Br)=CN1
Synonyms:- 2-Pyrimidinamine, 5-bromo-N-(2,2,2-trifluoroethyl)-
- 5-Bromo-N-(2,2,2-trifluoroethyl)-2-pyrimidinamine
- 5-BroMo-N-(2,2,2-trifluoroethyl)pyriMidin-2-aMine
- 5-Bromo-2-(2,2,2-trifluoroethyl)aminopyrimidine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
