CAS 1245563-10-3
:Benzamide, 4-bromo-2-ethoxy-N-ethyl-
Description:
Benzamide, 4-bromo-2-ethoxy-N-ethyl- is an organic compound characterized by its benzamide structure, which features a benzene ring attached to a carbonyl group (C=O) and an amine group (NH). The presence of a bromine atom at the para position (4-bromo) and an ethoxy group (-OCH2CH3) at the ortho position (2-ethoxy) contributes to its unique chemical properties. The N-ethyl substitution indicates that an ethyl group is attached to the nitrogen atom of the amide. This compound is likely to exhibit moderate polarity due to the presence of the amide functional group, which can engage in hydrogen bonding. Its bromine substituent may impart some degree of reactivity, particularly in electrophilic aromatic substitution reactions. Additionally, the ethoxy group can influence solubility and reactivity, making the compound potentially useful in various chemical applications, including pharmaceuticals and agrochemicals. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C11H14BrNO2
InChI:InChI=1S/C11H14BrNO2/c1-3-13-11(14)9-6-5-8(12)7-10(9)15-4-2/h5-7H,3-4H2,1-2H3,(H,13,14)
InChI key:InChIKey=ICNPLCHNYJXCQA-UHFFFAOYSA-N
SMILES:O(CC)C1=C(C(NCC)=O)C=CC(Br)=C1
Synonyms:- Benzamide, 4-bromo-2-ethoxy-N-ethyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
