CAS 1245563-16-9
:Benzamide, 4-bromo-2-ethoxy-N-methyl-
Description:
Benzamide, 4-bromo-2-ethoxy-N-methyl- is an organic compound characterized by the presence of a benzamide functional group, which consists of a benzene ring attached to a carbonyl group (C=O) and an amine (NH) moiety. The specific structure includes a bromine atom at the para position relative to the amide group, an ethoxy group (-OCH2CH3) at the ortho position, and a methyl group attached to the nitrogen of the amide. This compound is likely to exhibit moderate solubility in organic solvents due to its hydrophobic benzene ring and ethoxy group, while the amide functionality can engage in hydrogen bonding, potentially enhancing its solubility in polar solvents. The presence of the bromine substituent may impart unique reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions. Additionally, the compound may possess biological activity, which could be of interest in pharmaceutical research. As with many organic compounds, safety and handling precautions should be observed due to potential toxicity or reactivity.
Formula:C10H12BrNO2
InChI:InChI=1S/C10H12BrNO2/c1-3-14-9-6-7(11)4-5-8(9)10(13)12-2/h4-6H,3H2,1-2H3,(H,12,13)
InChI key:InChIKey=BATTWSDSGWAEMC-UHFFFAOYSA-N
SMILES:C(NC)(=O)C1=C(OCC)C=C(Br)C=C1
Synonyms:- Benzamide, 4-bromo-2-ethoxy-N-methyl-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
