CAS 1245563-19-2
:4-Bromo-N-ethyl-2-methoxybenzamide
Description:
4-Bromo-N-ethyl-2-methoxybenzamide is an organic compound characterized by its bromine, ethyl, and methoxy functional groups attached to a benzamide structure. The presence of the bromine atom introduces a halogen, which can influence the compound's reactivity and polarity. The ethyl group contributes to the hydrophobic character, while the methoxy group enhances solubility in organic solvents due to its ether functionality. This compound typically exhibits moderate to high stability under standard conditions, but its reactivity can be influenced by the presence of the bromine atom, which can participate in nucleophilic substitution reactions. The benzamide moiety suggests potential applications in medicinal chemistry, as amides are often found in biologically active compounds. Additionally, the compound's structure may allow for interactions with biological targets, making it of interest in drug design and development. Overall, 4-Bromo-N-ethyl-2-methoxybenzamide is a versatile compound with potential applications in various fields, including pharmaceuticals and organic synthesis.
Formula:C10H12BrNO2
InChI:InChI=1S/C10H12BrNO2/c1-3-12-10(13)8-5-4-7(11)6-9(8)14-2/h4-6H,3H2,1-2H3,(H,12,13)
InChI key:InChIKey=DXGNTNGOHSQCCK-UHFFFAOYSA-N
SMILES:C(NCC)(=O)C1=C(OC)C=C(Br)C=C1
Synonyms:- Benzamide, 4-bromo-N-ethyl-2-methoxy-
- 4-Bromo-N-ethyl-2-methoxybenzamide
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
