CymitQuimica logo

CAS 1245563-22-7

:

5-Bromo-2-(1,1-dimethylethyl)-2,3-dihydro-3-hydroxy-1H-isoindol-1-one

Description:
5-Bromo-2-(1,1-dimethylethyl)-2,3-dihydro-3-hydroxy-1H-isoindol-1-one is a chemical compound characterized by its isoindole structure, which features a bromine atom and a tert-butyl group. This compound typically exhibits properties associated with both aromatic and aliphatic systems due to its unique molecular framework. The presence of the hydroxyl group contributes to its potential reactivity, making it a candidate for various chemical reactions, including nucleophilic substitutions and hydrogen bonding interactions. The bromine substituent can enhance the compound's electrophilic character, potentially influencing its reactivity in organic synthesis. Additionally, the bulky tert-butyl group may impart steric hindrance, affecting the compound's interactions with other molecules. This compound may have applications in medicinal chemistry or materials science, although specific biological activities or industrial uses would depend on further research and characterization. Overall, its structural features suggest a versatile compound with potential utility in various chemical contexts.
Formula:C12H14BrNO2
InChI:InChI=1S/C12H14BrNO2/c1-12(2,3)14-10(15)8-5-4-7(13)6-9(8)11(14)16/h4-6,11,16H,1-3H3
InChI key:InChIKey=VAUUWFDGCFIPDZ-UHFFFAOYSA-N
SMILES:O=C1C=2C(C(O)N1C(C)(C)C)=CC(Br)=CC2
Synonyms:
  • 5-Bromo-2-(1,1-dimethylethyl)-2,3-dihydro-3-hydroxy-1H-isoindol-1-one
  • 1H-Isoindol-1-one, 5-bromo-2-(1,1-dimethylethyl)-2,3-dihydro-3-hydroxy-
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.