CAS 1245568-74-4

2-Thiophenemethanamine, N-cyclopentyl-, hydrochloride (1:1)

Description:

2-Thiophenemethanamine, N-cyclopentyl-, hydrochloride (1:1) is a chemical compound characterized by its thiophene ring structure, which contributes to its aromatic properties and potential biological activity. The presence of the cyclopentyl group enhances its lipophilicity, potentially influencing its interaction with biological membranes. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, which can facilitate its use in various applications, including pharmaceuticals. This compound may exhibit properties such as being a potential neurotransmitter or receptor modulator, given its amine functional group. Its molecular structure suggests it could participate in hydrogen bonding, affecting its reactivity and interaction with other molecules. Safety and handling precautions should be observed, as with many amines and thiophene derivatives, due to potential toxicity or reactivity. Overall, 2-Thiophenemethanamine, N-cyclopentyl-, hydrochloride (1:1) represents a unique compound with potential applications in medicinal chemistry and materials science.

Formula: C₁₀H₁₅NS·ClH

InChI: InChI=1S/C10H15NS.ClH/c1-2-5-9(4-1)11-8-10-6-3-7-12-10;/h3,6-7,9,11H,1-2,4-5,8H2;1H

InChI key: InChIKey=CQWMBBHKXJIMPZ-UHFFFAOYSA-N

SMILES: C(NC1CCCC1)C2=CC=CS2.Cl

Synonyms:

• 2-Thiophenemethanamine, N-cyclopentyl-, hydrochloride (1:1)