CAS 1245569-34-9

1H-Benzimidazole-2-propanamine, 1-methyl-, hydrochloride (1:2)

Description:

1H-Benzimidazole-2-propanamine, 1-methyl-, hydrochloride (1:2) is a chemical compound characterized by its benzimidazole core, which is a bicyclic structure containing both benzene and imidazole rings. This compound features a propanamine side chain with a methyl group, contributing to its unique properties. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceuticals. The presence of the hydrochloride group often indicates that the compound may exhibit enhanced stability and bioavailability. This substance may be of interest in medicinal chemistry due to its potential biological activities, which could include effects on neurotransmitter systems or other physiological pathways. Its specific interactions and mechanisms of action would require further investigation through experimental studies. Overall, 1H-Benzimidazole-2-propanamine, 1-methyl-, hydrochloride (1:2) represents a class of compounds that may hold promise in drug development and therapeutic applications.

Formula: C₁₁H₁₅N₃·2ClH

InChI: InChI=1S/C11H15N3.2ClH/c1-14-10-6-3-2-5-9(10)13-11(14)7-4-8-12;;/h2-3,5-6H,4,7-8,12H2,1H3;2*1H

InChI key: InChIKey=CUGLLFWUOPQCGN-UHFFFAOYSA-N

SMILES: CN1C=2C(N=C1CCCN)=CC=CC2.Cl

Synonyms:

• 1H-Benzimidazole-2-propanamine, 1-methyl-, hydrochloride (1:2)

3-(1-methyl-1H-benzo[d]imidazol-2-yl)propan-1-amine dihydrochloride

CAS: 1245569-34-9

Formula: C₁₁H₁₇Cl₂N₃

Purity: 95.0%

Molecular weight: 262.18

Ref: 10-F495133

3-(1-Methyl-1H-1,3-benzodiazol-2-yl)propan-1-amine dihydrochloride

Controlled Product

CAS: 1245569-34-9

Versatile small molecule scaffold

Formula: C₁₁H₁₇Cl₂N₃

Purity: Min. 95%

Molecular weight: 262.18 g/mol

Ref: 3D-VZB56934