CAS 1245569-49-6

Propanamide, 3-amino-N-(2-phenylethyl)-, hydrochloride (1:1)

Description:

Propanamide, 3-amino-N-(2-phenylethyl)-, hydrochloride (1:1), with the CAS number 1245569-49-6, is a chemical compound characterized by its amide functional group and an amino group attached to a propanamide backbone. This compound features a phenylethyl substituent, which contributes to its unique properties and potential biological activity. As a hydrochloride salt, it is typically more soluble in water compared to its free base form, enhancing its utility in various applications, particularly in pharmaceutical formulations. The presence of the amino group suggests potential interactions with biological systems, making it of interest in medicinal chemistry. Its structure may influence its pharmacokinetic properties, such as absorption, distribution, metabolism, and excretion. Additionally, the compound's stability, reactivity, and potential for forming hydrogen bonds can be significant in determining its behavior in chemical reactions and biological interactions. Overall, this compound's characteristics make it a subject of interest for further research in drug development and related fields.

Formula: C₁₁H₁₆N₂O·ClH

InChI: InChI=1S/C11H16N2O.ClH/c12-8-6-11(14)13-9-7-10-4-2-1-3-5-10;/h1-5H,6-9,12H2,(H,13,14);1H

InChI key: InChIKey=RHKUGPOIZZIMBS-UHFFFAOYSA-N

SMILES: C(CNC(CCN)=O)C1=CC=CC=C1.Cl

Synonyms:

• Propanamide, 3-amino-N-(2-phenylethyl)-, hydrochloride (1:1)

3-amino-N-phenethylpropanamide hydrochloride

CAS: 1245569-49-6

Formula: C₁₁H₁₇ClN₂O

Purity: 95.0%

Molecular weight: 228.72

Ref: 10-F496166