CAS 1245569-58-7

1,2,3,4-Tetrahydro-5-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxylic acid

Description:

1,2,3,4-Tetrahydro-5-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxylic acid is a heterocyclic compound characterized by its complex bicyclic structure, which incorporates both pyridine and pyrimidine rings. This compound features a tetrahydro configuration, indicating the presence of four hydrogen atoms that saturate the rings, contributing to its stability and reactivity. The presence of two carbonyl groups (dioxo) enhances its potential for various chemical reactions, including nucleophilic attacks and condensation reactions. The carboxylic acid functional group at the 7-position provides acidic properties, making it capable of participating in acid-base reactions. Additionally, the methyl group at the 5-position can influence the compound's solubility and biological activity. This compound may exhibit interesting pharmacological properties, making it a subject of interest in medicinal chemistry. Its unique structural features suggest potential applications in drug development, particularly in targeting specific biological pathways. However, detailed studies would be necessary to fully understand its reactivity, stability, and potential therapeutic uses.

Formula: C₉H₇N₃O₄

InChI: InChI=1S/C9H7N3O4/c1-3-2-4(8(14)15)10-6-5(3)7(13)12-9(16)11-6/h2H,1H3,(H,14,15)(H2,10,11,12,13,16)

InChI key: InChIKey=QWFSZGNCFXZWPF-UHFFFAOYSA-N

SMILES: CC1=C2C(=NC(C(O)=O)=C1)NC(=O)NC2=O

Synonyms:

• 2-Hydroxy-5-methyl-4-oxo-3H,4H-pyrido[2,3-d]pyrimidine-7-carboxylic acid
• Pyrido[2,3-d]pyrimidine-7-carboxylic acid, 1,2,3,4-tetrahydro-5-methyl-2,4-dioxo-
• 1,2,3,4-Tetrahydro-5-methyl-2,4-dioxopyrido[2,3-d]pyrimidine-7-carboxylic acid

2-Hydroxy-5-methyl-4-oxo-3H,4H-pyrido[2,3-d]pyrimidine-7-carboxylic acid

CAS: 1245569-58-7

Versatile small molecule scaffold

Formula: C₉H₇N₃O₄

Purity: Min. 95%

Molecular weight: 221.17 g/mol

Ref: 3D-VZB56958