CAS 1245606-71-6

1-[4-[2-(4-Methylphenyl)-1,2-diphenylethenyl]phenyl]-1H-pyrrole-2,5-dione

Description:

1-[4-[2-(4-Methylphenyl)-1,2-diphenylethenyl]phenyl]-1H-pyrrole-2,5-dione, identified by its CAS number 1245606-71-6, is a synthetic organic compound characterized by its complex molecular structure, which includes a pyrrole ring and multiple aromatic systems. This compound features a pyrrole-2,5-dione moiety, indicating the presence of two carbonyl groups within the pyrrole framework, contributing to its reactivity and potential applications in organic synthesis. The presence of multiple phenyl groups and a methyl-substituted phenyl group suggests that it may exhibit interesting electronic properties and could be relevant in materials science, particularly in the development of organic semiconductors or dyes. Additionally, the compound's structure implies potential interactions with biological systems, making it a candidate for further investigation in medicinal chemistry. Its solubility, stability, and reactivity would depend on the specific conditions and solvents used, which are critical for determining its practical applications. Overall, this compound represents a fascinating example of complex organic chemistry with potential utility in various fields.

Formula: C₃₁H₂₃NO₂

InChI: InChI=1S/C31H23NO2/c1-22-12-14-25(15-13-22)30(23-8-4-2-5-9-23)31(24-10-6-3-7-11-24)26-16-18-27(19-17-26)32-28(33)20-21-29(32)34/h2-21H,1H3

InChI key: InChIKey=CIMVFJJQFXGASK-UHFFFAOYSA-N

SMILES: C(=C(C1=CC=C(C)C=C1)C2=CC=CC=C2)(C3=CC=C(C=C3)N4C(=O)C=CC4=O)C5=CC=CC=C5

Synonyms:

• 1H-Pyrrole-2,5-dione, 1-[4-[2-(4-methylphenyl)-1,2-diphenylethenyl]phenyl]-
• 1-[4-[2-(4-Methylphenyl)-1,2-diphenylethenyl]phenyl]-1H-pyrrole-2,5-dione

TPE-MI

CAS: 1245606-71-6

TPE-MI

Purity: ≥95%

Molecular weight: 441.52g/mol

Ref: 54-BUP02811

TPE-MI

CAS: 1245606-71-6

TPE-MI (Tetraphenylethene maleimide) is an aggregation-induced luminogen that stains living cells.

Formula: C₃₁H₂₃NO₂

Purity: 97.17%

Color and Shape: Solid

Molecular weight: 441.52

Ref: TM-T74247