CAS 1245642-99-2

Quinoline, 5,7-dichloro-1,2,3,4-tetrahydro-, hydrochloride (1:1)

Description:

Quinoline, 5,7-dichloro-1,2,3,4-tetrahydro-, hydrochloride (1:1) is a chemical compound characterized by its quinoline backbone, which is a bicyclic structure consisting of a benzene ring fused to a pyridine ring. The presence of dichloro substituents at the 5 and 7 positions of the quinoline structure indicates that it has two chlorine atoms attached, which can influence its reactivity and biological activity. As a tetrahydro derivative, it features a saturated ring system, which typically enhances its solubility and alters its pharmacological properties. The hydrochloride form suggests that the compound is a salt, which can improve its stability and solubility in aqueous solutions. This compound may exhibit various biological activities, making it of interest in medicinal chemistry and pharmacology. Its specific applications and effects would depend on further studies and context, including its interaction with biological targets. As with many chemical substances, safety and handling precautions should be observed due to potential toxicity or reactivity.

Formula: C₉H₉Cl₂N·ClH

InChI: InChI=1S/C9H9Cl2N.ClH/c10-6-4-8(11)7-2-1-3-12-9(7)5-6;/h4-5,12H,1-3H2;1H

InChI key: InChIKey=MXFYPHDGIYFOEF-UHFFFAOYSA-N

SMILES: ClC1=C2C(=CC(Cl)=C1)NCCC2.Cl

Synonyms:

• Quinoline, 5,7-dichloro-1,2,3,4-tetrahydro-, hydrochloride (1:1)

5,7-Dichloro-1,2,3,4-tetrahydroquinoline hydrochloride

CAS: 1245642-99-2

Versatile small molecule scaffold

Formula: C₉H₁₀Cl₃N

Purity: Min. 95%

Molecular weight: 238.5 g/mol

Ref: 3D-VZB64299