CymitQuimica logo

CAS 1245643-16-6

:

4-(Difluoromethyl)bicyclo[2.2.2]octan-1-amine

Description:
4-(Difluoromethyl)bicyclo[2.2.2]octan-1-amine is a bicyclic organic compound characterized by its unique bicyclo[2.2.2]octane structure, which consists of a fused ring system that contributes to its rigidity and potential steric effects. The presence of a difluoromethyl group introduces significant electronegativity and influences the compound's reactivity and polarity. The amine functional group at the 1-position of the bicyclic framework suggests potential for hydrogen bonding and reactivity in various chemical reactions, including nucleophilic substitutions. This compound may exhibit interesting pharmacological properties due to its structural features, making it a candidate for further investigation in medicinal chemistry. Additionally, the difluoromethyl group can enhance lipophilicity, potentially affecting the compound's bioavailability and interaction with biological targets. Overall, the combination of its bicyclic structure, functional groups, and fluorine substituents makes 4-(difluoromethyl)bicyclo[2.2.2]octan-1-amine a compound of interest in both synthetic and medicinal chemistry contexts.
Formula:C9H15F2N
InChI:InChI=1S/C9H15F2N/c10-7(11)8-1-4-9(12,5-2-8)6-3-8/h7H,1-6,12H2
InChI key:InChIKey=UCZUVCWTOKXZTK-UHFFFAOYSA-N
SMILES:C(F)(F)C12CCC(N)(CC1)CC2
Synonyms:
  • Bicyclo[2.2.2]octan-1-amine, 4-(difluoromethyl)-
  • 4-(Difluoromethyl)bicyclo[2.2.2]octan-1-amine
Sort by

The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.