CAS 1245643-19-9

N-[(1R)-3-Hydroxy-1-(hydroxymethyl)propyl]benzamide

Description:

N-[(1R)-3-Hydroxy-1-(hydroxymethyl)propyl]benzamide is a chemical compound characterized by its amide functional group, which is linked to a benzene ring and a chiral propyl side chain. The presence of the hydroxymethyl and hydroxy groups indicates that this compound has potential for hydrogen bonding, which can influence its solubility and reactivity. The specific stereochemistry at the chiral center (1R) suggests that the compound may exhibit unique biological activity or interactions, making it of interest in pharmaceutical applications. The molecular structure implies that it may participate in various chemical reactions, including acylation and substitution reactions, due to the reactivity of the amide bond. Additionally, the compound's properties, such as melting point, boiling point, and solubility, would depend on the overall molecular interactions and the presence of functional groups. Overall, N-[(1R)-3-Hydroxy-1-(hydroxymethyl)propyl]benzamide represents a complex organic molecule with potential applications in medicinal chemistry and biochemistry.

Formula: C₁₁H₁₅NO₃

InChI: InChI=1S/C11H15NO3/c13-7-6-10(8-14)12-11(15)9-4-2-1-3-5-9/h1-5,10,13-14H,6-8H2,(H,12,15)/t10-/m1/s1

InChI key: InChIKey=HDOSGIOHZHZDEH-SNVBAGLBSA-N

SMILES: C(N[C@H](CCO)CO)(=O)C1=CC=CC=C1

Synonyms:

• (R)-N-(1,4-Dihydroxybutan-2-yl)benzamide
• N-[(1R)-3-Hydroxy-1-(hydroxymethyl)propyl]benzamide
• Benzamide, N-[(1R)-3-hydroxy-1-(hydroxymethyl)propyl]-

Benzamide, N-[(1R)-3-hydroxy-1-(hydroxymethyl)propyl]-

CAS: 1245643-19-9

Formula: C₁₁H₁₅NO₃

Purity: 95%

Color and Shape: Solid

Molecular weight: 209.2417

Ref: IN-DA000M8F

(R)-N-(1,4-Dihydroxybutan-2-yl)benzamide

CAS: 1245643-19-9

(R)-N-(1,4-Dihydroxybutan-2-yl)benzamide

Purity: 95%

Molecular weight: 209.25g/mol

Ref: 54-OR1044767