CAS 1245643-27-9
:2-Chloro-4-(3-pyridinylmethyl)pyrimidine
Description:
2-Chloro-4-(3-pyridinylmethyl)pyrimidine is a heterocyclic organic compound characterized by its pyrimidine core, which is a six-membered ring containing two nitrogen atoms at positions 1 and 3. The presence of a chloro group at the 2-position introduces a halogen, enhancing its reactivity and potential for further chemical modifications. The 4-position features a pyridinylmethyl substituent, which contributes to the compound's biological activity and solubility properties. This compound is often studied for its potential applications in medicinal chemistry, particularly in the development of pharmaceuticals targeting various biological pathways. Its structural features suggest that it may exhibit interactions with specific receptors or enzymes, making it a candidate for further investigation in drug discovery. Additionally, the presence of both chlorine and a pyridine moiety may influence its electronic properties, stability, and overall reactivity in synthetic pathways. As with many heterocycles, the compound's properties can be significantly affected by its environment, including solvent effects and pH.
Formula:C10H8ClN3
InChI:InChI=1S/C10H8ClN3/c11-10-13-5-3-9(14-10)6-8-2-1-4-12-7-8/h1-5,7H,6H2
InChI key:InChIKey=NKYCEVZRVCRKJY-UHFFFAOYSA-N
SMILES:C(C1=NC(Cl)=NC=C1)C=2C=CC=NC2
Synonyms:- 2-Chloro-4-(3-pyridinylmethyl)pyrimidine
- Pyrimidine, 2-chloro-4-(3-pyridinylmethyl)-
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
