CAS 1245643-66-6
:5-Bromo-3-nitro-2-(phenylmethoxy)pyridine
Description:
5-Bromo-3-nitro-2-(phenylmethoxy)pyridine is a chemical compound characterized by its pyridine ring, which is a six-membered aromatic heterocycle containing one nitrogen atom. The presence of a bromine atom at the 5-position and a nitro group at the 3-position contributes to its reactivity and potential applications in organic synthesis and medicinal chemistry. The phenylmethoxy group at the 2-position enhances its lipophilicity, which may influence its biological activity and solubility in organic solvents. This compound is likely to exhibit polar characteristics due to the nitro group, while the bromine and methoxy functionalities can participate in various chemical reactions, such as nucleophilic substitutions or electrophilic aromatic substitutions. Its unique structure may make it a candidate for research in drug development or as an intermediate in the synthesis of more complex molecules. As with many organic compounds, safety precautions should be taken when handling it, considering potential toxicity and environmental impact.
Formula:C12H9BrN2O3
InChI:InChI=1S/C12H9BrN2O3/c13-10-6-11(15(16)17)12(14-7-10)18-8-9-4-2-1-3-5-9/h1-7H,8H2
InChI key:InChIKey=MMNAEFZPFOIVGP-UHFFFAOYSA-N
SMILES:O(CC1=CC=CC=C1)C2=C(N(=O)=O)C=C(Br)C=N2
Synonyms:- Pyridine, 5-bromo-3-nitro-2-(phenylmethoxy)-
- 2-(Benzyloxy)-5-bromo-3-nitropyridine
- 5-Bromo-3-nitro-2-(phenylmethoxy)pyridine
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
