
CAS 1245643-73-5
:5-Cyclopropyl-3-thiophenecarbonitrile
Description:
5-Cyclopropyl-3-thiophenecarbonitrile is an organic compound characterized by its unique structural features, which include a cyclopropyl group and a thiophene ring. The presence of the carbonitrile functional group (-C≡N) indicates that it has a strong dipole moment, contributing to its reactivity and potential applications in organic synthesis. The cyclopropyl moiety introduces ring strain, which can enhance the compound's reactivity compared to more stable aliphatic groups. The thiophene ring, a five-membered aromatic heterocycle containing sulfur, imparts additional electronic properties, making the compound potentially useful in materials science and medicinal chemistry. This compound may exhibit interesting biological activities due to its structural components, and its synthesis typically involves multi-step organic reactions. As with many nitriles, it may also participate in nucleophilic addition reactions or serve as a precursor for further functionalization. Overall, 5-Cyclopropyl-3-thiophenecarbonitrile represents a versatile building block in the field of organic chemistry.
Formula:C8H7NS
InChI:InChI=1S/C8H7NS/c9-4-6-3-8(10-5-6)7-1-2-7/h3,5,7H,1-2H2
InChI key:InChIKey=HRYIHVSSBLATOZ-UHFFFAOYSA-N
SMILES:C(#N)C=1C=C(SC1)C2CC2
Synonyms:- 3-Thiophenecarbonitrile, 5-cyclopropyl-
- 5-Cyclopropyl-3-thiophenecarbonitrile
Sort by
The purity filter is not visible because current products do not have associated purity data for filtering.
Found 1 products.
