CymitQuimica logo

CAS 1245643-75-7

:

5-Chloro-1H-pyrazolo[3,4-b]pyridin-3-amine

Description:
5-Chloro-1H-pyrazolo[3,4-b]pyridin-3-amine is a heterocyclic organic compound characterized by its pyrazolo-pyridine structure, which consists of a fused pyrazole and pyridine ring system. The presence of a chlorine atom at the 5-position and an amino group at the 3-position contributes to its unique chemical properties. This compound is typically a solid at room temperature and may exhibit moderate solubility in polar solvents due to the amino group, which can engage in hydrogen bonding. It is of interest in medicinal chemistry for its potential biological activities, including anti-inflammatory and anticancer properties. The compound's reactivity can be influenced by the electron-withdrawing nature of the chlorine substituent, which can affect its interaction with biological targets. Additionally, its structural features may allow for further derivatization, making it a valuable scaffold in drug design. As with many nitrogen-containing heterocycles, it may also exhibit interesting electronic properties, making it a subject of study in materials science and organic electronics.
Formula:C6H5ClN4
InChI:InChI=1S/C6H5ClN4/c7-3-1-4-5(8)10-11-6(4)9-2-3/h1-2H,(H3,8,9,10,11)
InChI key:InChIKey=WOTJLFCDHRGDBB-UHFFFAOYSA-N
SMILES:NC=1C=2C(=NC=C(Cl)C2)NN1
Synonyms:
  • 5-Chloro-1H-pyrazolo[3,4-b]pyridin-3-amine
  • 1H-Pyrazolo[3,4-b]pyridin-3-amine, 5-chloro-
Found 2 products.