CAS 1245643-76-8

Piperidine, 4-hydrazinyl-1-methyl-, hydrochloride (1:3)

Description:

Piperidine, 4-hydrazinyl-1-methyl-, hydrochloride (1:3) is a chemical compound characterized by its piperidine ring structure, which is a six-membered saturated heterocycle containing one nitrogen atom. The presence of a hydrazinyl group at the 4-position of the piperidine ring indicates that it has a hydrazine functional group, which can participate in various chemical reactions, including those involving nucleophilic attack. The methyl group at the 1-position contributes to its overall stability and solubility. As a hydrochloride salt, it is typically more soluble in water than its free base form, making it useful in various applications, including pharmaceuticals and organic synthesis. The compound may exhibit biological activity, potentially acting as a precursor or intermediate in the synthesis of more complex molecules. Safety data should be consulted for handling and storage, as compounds containing hydrazine derivatives can be hazardous. Overall, this compound's unique structure and properties make it of interest in both research and industrial contexts.

Formula: C₆H₁₅N₃·3ClH

InChI: InChI=1S/C6H15N3.3ClH/c1-9-4-2-6(8-7)3-5-9;;;/h6,8H,2-5,7H2,1H3;3*1H

InChI key: InChIKey=OTZOMYKLOPLHSE-UHFFFAOYSA-N

SMILES: N(N)C1CCN(C)CC1.Cl

Synonyms:

• Piperidine, 4-hydrazinyl-1-methyl-, hydrochloride (1:3)